C16H20ClN3 — CID 54045139
5-[2-(4-chlorophenyl)-2-ethenylhexyl]-1H-1,2,4-triazole (PubChem CID 54045139) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-2-ethenylhexyl]-1H-1,2,4-triazole.
| Compound Name | 5-[2-(4-chlorophenyl)-2-ethenylhexyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 54045139 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-2-ethenylhexyl]-1H-1,2,4-triazole |
| SMILES | C=CC(CCCC)(Cc1ncn[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3/c1-3-5-10-16(4-2,11-15-18-12-19-20-15)13-6-8-14(17)9-7-13/h4,6-9,12H,2-3,5,10-11H2,1H3,(H,18,19,20) |
| InChIKey | LPAFIKBCPSDHKW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|