C19H20N2O2 — CID 54045232
8-N,10-N-diethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-8,10-diimine (PubChem CID 54045232) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 8-N,10-N-diethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-8,10-diimine.
| Compound Name | 8-N,10-N-diethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-8,10-diimine |
|---|---|
| PubChem CID | 54045232 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 8-N,10-N-diethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-8,10-diimine |
| SMILES | CCON=C1CC(=NOCC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H20N2O2/c1-3-22-20-18-13-19(21-23-4-2)17-12-8-6-10-15(17)14-9-5-7-11-16(14)18/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | LPBZZBSCPXXLTJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|