C21H28N4O2 — CID 54045288
1-(2,6-dimethylphenyl)-3-[N'-methyl-N-[2-(2-phenylethoxy)ethyl]carbamimidoyl]urea (PubChem CID 54045288) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[N'-methyl-N-[2-(2-phenylethoxy)ethyl]carbamimidoyl]urea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[N'-methyl-N-[2-(2-phenylethoxy)ethyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 54045288 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[N'-methyl-N-[2-(2-phenylethoxy)ethyl]carbamimidoyl]urea |
| SMILES | C/N=C(\NCCOCCc1ccccc1)NC(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C21H28N4O2/c1-16-8-7-9-17(2)19(16)24-21(26)25-20(22-3)23-13-15-27-14-12-18-10-5-4-6-11-18/h4-11H,12-15H2,1-3H3,(H3,22,23,24,25,26) |
| InChIKey | LPCYZQZPVCYFFS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|