C18H33N7O4 — CID 54045526
2,2-dimethyl-N-[2-methyl-4-(2-nitroimidazol-1-yl)-3-nitrosobutan-2-yl]-N'-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine (PubChem CID 54045526) has the molecular formula C18H33N7O4 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-methyl-4-(2-nitroimidazol-1-yl)-3-nitrosobutan-2-yl]-N'-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine.
| Compound Name | 2,2-dimethyl-N-[2-methyl-4-(2-nitroimidazol-1-yl)-3-nitrosobutan-2-yl]-N'-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54045526 |
| Molecular Formula | C18H33N7O4 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2,2-dimethyl-N-[2-methyl-4-(2-nitroimidazol-1-yl)-3-nitrosobutan-2-yl]-N'-(2-methyl-3-nitrosobutan-2-yl)propane-1,3-diamine |
| SMILES | CC(N=O)C(C)(C)NCC(C)(C)CNC(C)(C)C(Cn1ccnc1[N+](=O)[O-])N=O |
| InChI | InChI=1S/C18H33N7O4/c1-13(22-26)17(4,5)20-11-16(2,3)12-21-18(6,7)14(23-27)10-24-9-8-19-15(24)25(28)29/h8-9,13-14,20-21H,10-12H2,1-7H3 |
| InChIKey | LPHOPOAUCAIYTC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 143.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|