About 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene
6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene (PubChem CID 54045536) has the molecular formula C11H21N2O2+
and a molecular weight of 213.30 g/mol. Its IUPAC name is 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene.
Molecular Properties
| Compound Name | 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene |
| PubChem CID | 54045536 |
| Molecular Formula | C11H21N2O2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene |
| SMILES | CCCCC1=NCCOC[N+]12CCOC2 |
| InChI | InChI=1S/C11H21N2O2/c1-2-3-4-11-12-5-7-14-9-13(11)6-8-15-10-13/h2-10H2,1H3/q+1 |
| InChIKey | AZCPMIBOHZJFIA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene?
The IUPAC name of 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene (CID 54045536) is 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene.
What is the SMILES notation for 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene?
The canonical SMILES for 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene is CCCCC1=NCCOC[N+]12CCOC2.
What is the InChIKey of 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene?
The InChIKey is AZCPMIBOHZJFIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N2O2/c1-2-3-4-11-12-5-7-14-9-13(11)6-8-15-10-13/h2-10H2,1H3/q+1.
What are the key properties of 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene?
6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene has a molecular weight of 213.30 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-2,10-dioxa-7-aza-5-azoniaspiro[4.6]undec-6-ene is sourced from PubChem (CID 54045536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).