C19H17N3O3 — CID 54045583
1-[3-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]pyrrole-2,5-diol (PubChem CID 54045583) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[3-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]pyrrole-2,5-diol.
| Compound Name | 1-[3-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54045583 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[3-[(1-methylbenzimidazol-2-yl)methoxy]phenyl]pyrrole-2,5-diol |
| SMILES | Cn1c(COc2cccc(-n3c(O)ccc3O)c2)nc2ccccc21 |
| InChI | InChI=1S/C19H17N3O3/c1-21-16-8-3-2-7-15(16)20-17(21)12-25-14-6-4-5-13(11-14)22-18(23)9-10-19(22)24/h2-11,23-24H,12H2,1H3 |
| InChIKey | LPIRJFAFQSOOEM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |