About 3-(hydroxymethyl)-1H-pyrrole-2,5-diol
3-(hydroxymethyl)-1H-pyrrole-2,5-diol (PubChem CID 54045776) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-1H-pyrrole-2,5-diol |
| PubChem CID | 54045776 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 3-(hydroxymethyl)-1H-pyrrole-2,5-diol |
| SMILES | OCc1cc(O)[nH]c1O |
| InChI | InChI=1S/C5H7NO3/c7-2-3-1-4(8)6-5(3)9/h1,6-9H,2H2 |
| InChIKey | LPMKQPIKCIGWGZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(hydroxymethyl)-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-1H-pyrrole-2,5-diol?
The IUPAC name of 3-(hydroxymethyl)-1H-pyrrole-2,5-diol (CID 54045776) is 3-(hydroxymethyl)-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-(hydroxymethyl)-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-(hydroxymethyl)-1H-pyrrole-2,5-diol is OCc1cc(O)[nH]c1O.
What is the InChIKey of 3-(hydroxymethyl)-1H-pyrrole-2,5-diol?
The InChIKey is LPMKQPIKCIGWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c7-2-3-1-4(8)6-5(3)9/h1,6-9H,2H2.
What are the key properties of 3-(hydroxymethyl)-1H-pyrrole-2,5-diol?
3-(hydroxymethyl)-1H-pyrrole-2,5-diol has a molecular weight of 129.11 g/mol, XLogP of -0.08, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-1H-pyrrole-2,5-diol is sourced from PubChem (CID 54045776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).