C16H12F3NO5S — CID 54045953
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-(trifluoromethyl)benzenesulfonate (PubChem CID 54045953) has the molecular formula C16H12F3NO5S and a molecular weight of 387.34 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-(trifluoromethyl)benzenesulfonate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 54045953 |
| Molecular Formula | C16H12F3NO5S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)C1C=CC2C1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3NO5S/c17-16(18,19)10-3-1-2-4-11(10)26(23,24)25-20-14(21)12-8-5-6-9(7-8)13(12)15(20)22/h1-6,8-9,21-22H,7H2 |
| InChIKey | LPPHQCQEBKVFSF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|