C7H13NO3 — CID 54046127
4,6-dimethoxy-2,3,4,5-tetrahydropyridin-5-ol (PubChem CID 54046127) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 4,6-dimethoxy-2,3,4,5-tetrahydropyridin-5-ol.
| Compound Name | 4,6-dimethoxy-2,3,4,5-tetrahydropyridin-5-ol |
|---|---|
| PubChem CID | 54046127 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 4,6-dimethoxy-2,3,4,5-tetrahydropyridin-5-ol |
| SMILES | COC1=NCCC(OC)C1O |
| InChI | InChI=1S/C7H13NO3/c1-10-5-3-4-8-7(11-2)6(5)9/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | LPSDYPHZXJRQAA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |