C21H29N7O2S4 — CID 54046765
N'-[2-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]ethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-(4-methylphenyl)sulfonylethanimidamide (PubChem CID 54046765) has the molecular formula C21H29N7O2S4 and a molecular weight of 539.78 g/mol. Its IUPAC name is N'-[2-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]ethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-(4-methylphenyl)sulfonylethanimidamide.
| Compound Name | N'-[2-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]ethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-(4-methylphenyl)sulfonylethanimidamide |
|---|---|
| PubChem CID | 54046765 |
| Molecular Formula | C21H29N7O2S4 |
| Molecular Weight | 539.78 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N'-[2-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]ethyl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-(4-methylphenyl)sulfonylethanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)C/C(=N/CCSCc2nnc(N)s2)NCCSCc2nc[nH]c2C)cc1 |
| InChI | InChI=1S/C21H29N7O2S4/c1-15-3-5-17(6-4-15)34(29,30)13-19(23-7-9-31-11-18-16(2)25-14-26-18)24-8-10-32-12-20-27-28-21(22)33-20/h3-6,14H,7-13H2,1-2H3,(H2,22,28)(H,23,24)(H,25,26) |
| InChIKey | LQCVKJCQGRKIFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|