C18H24 — CID 54047098
(13S,14R)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 54047098) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (13S,14R)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (13S,14R)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 54047098 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (13S,14R)-13-methyl-1,2,3,4,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@@]12CCC[C@H]1c1ccc3c(c1CC2)CCCC3 |
| InChI | InChI=1S/C18H24/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18/h8-9,17H,2-7,10-12H2,1H3/t17-,18-/m0/s1 |
| InChIKey | LQILYMOPFWZSIM-ROUUACIJSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |