C19H18N2O5 — CID 54047419
trans-(1,3-dioxoisoindol-2-yl)methyl (1R,3S)-2,2-dimethyl-3-(prop-2-ynoxyiminomethyl)cyclopropane-1-carboxylate (PubChem CID 54047419) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is trans-(1,3-dioxoisoindol-2-yl)methyl (1R,3S)-2,2-dimethyl-3-(prop-2-ynoxyiminomethyl)cyclopropane-1-carboxylate.
| Compound Name | trans-(1,3-dioxoisoindol-2-yl)methyl (1R,3S)-2,2-dimethyl-3-(prop-2-ynoxyiminomethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54047419 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | trans-(1,3-dioxoisoindol-2-yl)methyl (1R,3S)-2,2-dimethyl-3-(prop-2-ynoxyiminomethyl)cyclopropane-1-carboxylate |
| SMILES | C#CCON=C[C@H]1[C@@H](C(=O)OCN2C(=O)c3ccccc3C2=O)C1(C)C |
| InChI | InChI=1S/C19H18N2O5/c1-4-9-26-20-10-14-15(19(14,2)3)18(24)25-11-21-16(22)12-7-5-6-8-13(12)17(21)23/h1,5-8,10,14-15H,9,11H2,2-3H3/t14-,15-/m0/s1 |
| InChIKey | LQNMXZPJRIEPCR-GJZGRUSLSA-N |
| XLogP | 1.69 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|