C44H56N4O7 — CID 54047848
[(2R,3S,5R,6R)-6-(5-azidopentoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate (PubChem CID 54047848) has the molecular formula C44H56N4O7 and a molecular weight of 752.95 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-6-(5-azidopentoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate.
| Compound Name | [(2R,3S,5R,6R)-6-(5-azidopentoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 54047848 |
| Molecular Formula | C44H56N4O7 |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.41 |
| IUPAC Name | [(2R,3S,5R,6R)-6-(5-azidopentoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylbutanoate |
| SMILES | CC(c1ccccc1)C(C)(C)C(=O)O[C@H]1C[C@@H](OC(=O)C(C)(C)Cc2ccccc2)[C@](CCc2c[nH]c3ccccc23)(OCCCCCN=[N+]=[N-])O[C@@H]1CO |
| InChI | InChI=1S/C44H56N4O7/c1-31(33-19-11-7-12-20-33)43(4,5)41(51)53-37-27-39(54-40(50)42(2,3)28-32-17-9-6-10-18-32)44(55-38(37)30-49,52-26-16-8-15-25-47-48-45)24-23-34-29-46-36-22-14-13-21-35(34)36/h6-7,9-14,17-22,29,31,37-39,46,49H,8,15-16,23-28,30H2,1-5H3/t31?,37-,38+,39+,44+/m0/s1 |
| InChIKey | LQUOETRXEAPTLO-QVPVMGKPSA-N |
| XLogP | 9.00 |
| TPSA | 155.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|