About 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine
5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 54047986) has the molecular formula C17H9BrCl2N4S
and a molecular weight of 452.16 g/mol. Its IUPAC name is 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine |
| PubChem CID | 54047986 |
| Molecular Formula | C17H9BrCl2N4S |
| Molecular Weight | 452.16 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2nc(-c3cc(Cl)sc3Cl)cc(-c3cccc(Br)c3)c12 |
| InChI | InChI=1S/C17H9BrCl2N4S/c18-9-3-1-2-8(4-9)10-5-12(11-6-13(19)25-15(11)20)24-17-14(10)16(21)22-7-23-17/h1-7H,(H2,21,22,23,24) |
| InChIKey | LQWWZCPFTQXQOG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.16 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine (CID 54047986) is 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine is Nc1ncnc2nc(-c3cc(Cl)sc3Cl)cc(-c3cccc(Br)c3)c12.
What is the InChIKey of 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine?
The InChIKey is LQWWZCPFTQXQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrCl2N4S/c18-9-3-1-2-8(4-9)10-5-12(11-6-13(19)25-15(11)20)24-17-14(10)16(21)22-7-23-17/h1-7H,(H2,21,22,23,24).
What are the key properties of 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine?
5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine has a molecular weight of 452.16 g/mol, XLogP of 6.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromophenyl)-7-(2,5-dichlorothiophen-3-yl)pyrido[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 54047986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).