C17H24N5O3PS — CID 54048312
[2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4,5-dihydroimidazol-1-yl]-phenylmethoxyphosphinic acid (PubChem CID 54048312) has the molecular formula C17H24N5O3PS and a molecular weight of 409.45 g/mol. Its IUPAC name is [2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4,5-dihydroimidazol-1-yl]-phenylmethoxyphosphinic acid.
| Compound Name | [2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4,5-dihydroimidazol-1-yl]-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 54048312 |
| Molecular Formula | C17H24N5O3PS |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4,5-dihydroimidazol-1-yl]-phenylmethoxyphosphinic acid |
| SMILES | Cc1[nH]cnc1CSCCNC1=NCCN1P(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N5O3PS/c1-14-16(21-13-20-14)12-27-10-8-19-17-18-7-9-22(17)26(23,24)25-11-15-5-3-2-4-6-15/h2-6,13H,7-12H2,1H3,(H,18,19)(H,20,21)(H,23,24) |
| InChIKey | LRCSTIQPKIVYET-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|