C15H20N2O — CID 54048321
cyclopropyl-phenyl-(2,3,4,5-tetrahydropyridin-6-ylamino)methanol (PubChem CID 54048321) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is cyclopropyl-phenyl-(2,3,4,5-tetrahydropyridin-6-ylamino)methanol.
| Compound Name | cyclopropyl-phenyl-(2,3,4,5-tetrahydropyridin-6-ylamino)methanol |
|---|---|
| PubChem CID | 54048321 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | cyclopropyl-phenyl-(2,3,4,5-tetrahydropyridin-6-ylamino)methanol |
| SMILES | OC(NC1=NCCCC1)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C15H20N2O/c18-15(13-9-10-13,12-6-2-1-3-7-12)17-14-8-4-5-11-16-14/h1-3,6-7,13,18H,4-5,8-11H2,(H,16,17) |
| InChIKey | LRCVVMLLTMPTHP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|