C37H74N5O6P3 — CID 54048369
N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N'-[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]ethyl]-N,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 54048369) has the molecular formula C37H74N5O6P3 and a molecular weight of 777.95 g/mol. Its IUPAC name is N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N'-[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]ethyl]-N,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N'-[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]ethyl]-N,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54048369 |
| Molecular Formula | C37H74N5O6P3 |
| Molecular Weight | 777.95 g/mol |
| Exact Mass | 777.49 |
| IUPAC Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N'-[2-[(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)amino]ethyl]-N,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CC1(C)COP(NCCN(CC(C2CC(C)(C)NC(C)(C)C2)N(C2CC(C)(C)NC(C)(C)C2)P2OCC(C)(C)CO2)P2OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C37H74N5O6P3/c1-31(2)22-43-49(44-23-31)38-15-16-41(50-45-24-32(3,4)25-46-50)21-30(28-17-34(7,8)39-35(9,10)18-28)42(51-47-26-33(5,6)27-48-51)29-19-36(11,12)40-37(13,14)20-29/h28-30,38-40H,15-27H2,1-14H3 |
| InChIKey | LRDPXJIBOZTTPY-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.95 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|