C22H21N3O8S — CID 54048719
[6-(hydroxycarbamoyl)-5-(4-methoxyphenyl)sulfonyl-6,7-dihydro-4H-furo[3,2-c]pyridin-7-yl] N-phenylcarbamate (PubChem CID 54048719) has the molecular formula C22H21N3O8S and a molecular weight of 487.49 g/mol. Its IUPAC name is [6-(hydroxycarbamoyl)-5-(4-methoxyphenyl)sulfonyl-6,7-dihydro-4H-furo[3,2-c]pyridin-7-yl] N-phenylcarbamate.
| Compound Name | [6-(hydroxycarbamoyl)-5-(4-methoxyphenyl)sulfonyl-6,7-dihydro-4H-furo[3,2-c]pyridin-7-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 54048719 |
| Molecular Formula | C22H21N3O8S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | [6-(hydroxycarbamoyl)-5-(4-methoxyphenyl)sulfonyl-6,7-dihydro-4H-furo[3,2-c]pyridin-7-yl] N-phenylcarbamate |
| SMILES | COc1ccc(S(=O)(=O)N2Cc3ccoc3C(OC(=O)Nc3ccccc3)C2C(=O)NO)cc1 |
| InChI | InChI=1S/C22H21N3O8S/c1-31-16-7-9-17(10-8-16)34(29,30)25-13-14-11-12-32-19(14)20(18(25)21(26)24-28)33-22(27)23-15-5-3-2-4-6-15/h2-12,18,20,28H,13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | LRJDWZZQOLXVCS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|