C29H60O4Si2 — CID 54049562
3-[(1S,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(hydroxymethyl)cyclopentyl]propan-1-ol (PubChem CID 54049562) has the molecular formula C29H60O4Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is 3-[(1S,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(hydroxymethyl)cyclopentyl]propan-1-ol.
| Compound Name | 3-[(1S,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(hydroxymethyl)cyclopentyl]propan-1-ol |
|---|---|
| PubChem CID | 54049562 |
| Molecular Formula | C29H60O4Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | 3-[(1S,2S,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-(hydroxymethyl)cyclopentyl]propan-1-ol |
| SMILES | CCCCC[C@@H](C=C[C@H]1[C@@H](CCCO)[C@@H](CO)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O4Si2/c1-12-13-14-16-24(32-34(8,9)28(2,3)4)18-19-26-25(17-15-20-30)23(22-31)21-27(26)33-35(10,11)29(5,6)7/h18-19,23-27,30-31H,12-17,20-22H2,1-11H3/t23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | LRYBVLJJULIECS-NNRJALBFSA-N |
| XLogP | 7.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|