C21H34O5 — CID 54050027
2-hydroxy-2-[4-[(1R,2R)-1-methyl-2-(3-methylocta-1,5-dienyl)-5-oxocyclopentyl]butoxy]acetic acid (PubChem CID 54050027) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-hydroxy-2-[4-[(1R,2R)-1-methyl-2-(3-methylocta-1,5-dienyl)-5-oxocyclopentyl]butoxy]acetic acid.
| Compound Name | 2-hydroxy-2-[4-[(1R,2R)-1-methyl-2-(3-methylocta-1,5-dienyl)-5-oxocyclopentyl]butoxy]acetic acid |
|---|---|
| PubChem CID | 54050027 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-hydroxy-2-[4-[(1R,2R)-1-methyl-2-(3-methylocta-1,5-dienyl)-5-oxocyclopentyl]butoxy]acetic acid |
| SMILES | CCC=CCC(C)C=C[C@H]1CCC(=O)[C@]1(C)CCCCOC(O)C(=O)O |
| InChI | InChI=1S/C21H34O5/c1-4-5-6-9-16(2)10-11-17-12-13-18(22)21(17,3)14-7-8-15-26-20(25)19(23)24/h5-6,10-11,16-17,20,25H,4,7-9,12-15H2,1-3H3,(H,23,24)/t16?,17-,20?,21+/m0/s1 |
| InChIKey | LSFMKNGZUULULL-HPAHXVRCSA-N |
| XLogP | 4.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|