C10H4F12O4 — CID 54050058
2,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid (PubChem CID 54050058) has the molecular formula C10H4F12O4 and a molecular weight of 416.11 g/mol. Its IUPAC name is 2,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid.
| Compound Name | 2,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 54050058 |
| Molecular Formula | C10H4F12O4 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 2,3-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)but-2-enedioic acid |
| SMILES | O=C(O)C(=C(C(=O)O)C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F12O4/c11-7(12,13)3(8(14,15)16)1(5(23)24)2(6(25)26)4(9(17,18)19)10(20,21)22/h3-4H,(H,23,24)(H,25,26) |
| InChIKey | LSFYELMZVHZKKQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|