About 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide
10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide (PubChem CID 54050440) has the molecular formula C20H21N3S2
and a molecular weight of 367.54 g/mol. Its IUPAC name is 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide.
Molecular Properties
| Compound Name | 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide |
| PubChem CID | 54050440 |
| Molecular Formula | C20H21N3S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide |
| SMILES | CC(CN1CC=CC1)N1c2ccccc2Sc2ccc(C(N)=S)cc21 |
| InChI | InChI=1S/C20H21N3S2/c1-14(13-22-10-4-5-11-22)23-16-6-2-3-7-18(16)25-19-9-8-15(20(21)24)12-17(19)23/h2-9,12,14H,10-11,13H2,1H3,(H2,21,24) |
| InChIKey | LSNANTDBGWGJQN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide?
The IUPAC name of 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide (CID 54050440) is 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide.
What is the SMILES notation for 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide?
The canonical SMILES for 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide is CC(CN1CC=CC1)N1c2ccccc2Sc2ccc(C(N)=S)cc21.
What is the InChIKey of 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide?
The InChIKey is LSNANTDBGWGJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3S2/c1-14(13-22-10-4-5-11-22)23-16-6-2-3-7-18(16)25-19-9-8-15(20(21)24)12-17(19)23/h2-9,12,14H,10-11,13H2,1H3,(H2,21,24).
What are the key properties of 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide?
10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide has a molecular weight of 367.54 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[1-(2,5-dihydropyrrol-1-yl)propan-2-yl]phenothiazine-2-carbothioamide is sourced from PubChem (CID 54050440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).