C11H11F11O3 — CID 54050515
5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]pent-1-ene (PubChem CID 54050515) has the molecular formula C11H11F11O3 and a molecular weight of 400.18 g/mol. Its IUPAC name is 5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]pent-1-ene.
| Compound Name | 5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]pent-1-ene |
|---|---|
| PubChem CID | 54050515 |
| Molecular Formula | C11H11F11O3 |
| Molecular Weight | 400.18 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 5-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]pent-1-ene |
| SMILES | C=CCCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F11O3/c1-2-3-4-5-23-6-7(12,13)24-10(19,20)11(21,22)25-9(17,18)8(14,15)16/h2H,1,3-6H2 |
| InChIKey | LSOIFSWZAVBHHX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.18 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|