About phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate
phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate (PubChem CID 54051247) has the molecular formula C20H15N3O3S
and a molecular weight of 377.43 g/mol. Its IUPAC name is phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate.
Molecular Properties
| Compound Name | phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate |
| PubChem CID | 54051247 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate |
| SMILES | O=C(Oc1ccccc1)c1cccc(CS(=O)c2nc3ccncc3[nH]2)c1 |
| InChI | InChI=1S/C20H15N3O3S/c24-19(26-16-7-2-1-3-8-16)15-6-4-5-14(11-15)13-27(25)20-22-17-9-10-21-12-18(17)23-20/h1-12H,13H2,(H,22,23) |
| InChIKey | LSZYUYFMIPEIJT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate?
The IUPAC name of phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate (CID 54051247) is phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate.
What is the SMILES notation for phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate?
The canonical SMILES for phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate is O=C(Oc1ccccc1)c1cccc(CS(=O)c2nc3ccncc3[nH]2)c1.
What is the InChIKey of phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate?
The InChIKey is LSZYUYFMIPEIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O3S/c24-19(26-16-7-2-1-3-8-16)15-6-4-5-14(11-15)13-27(25)20-22-17-9-10-21-12-18(17)23-20/h1-12H,13H2,(H,22,23).
What are the key properties of phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate?
phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate has a molecular weight of 377.43 g/mol, XLogP of 3.48, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-(3H-imidazo[4,5-c]pyridin-2-ylsulfinylmethyl)benzoate is sourced from PubChem (CID 54051247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).