About 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene
4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene (PubChem CID 54052123) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene.
Molecular Properties
| Compound Name | 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene |
| PubChem CID | 54052123 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene |
| SMILES | CC1(C)C=CCCCC1C1CCC=CCC1 |
| InChI | InChI=1S/C16H26/c1-16(2)13-9-5-8-12-15(16)14-10-6-3-4-7-11-14/h3-4,9,13-15H,5-8,10-12H2,1-2H3 |
| InChIKey | JCOWMKPJABGCQO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene?
The IUPAC name of 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene (CID 54052123) is 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene.
What is the SMILES notation for 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene?
The canonical SMILES for 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene is CC1(C)C=CCCCC1C1CCC=CCC1.
What is the InChIKey of 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene?
The InChIKey is JCOWMKPJABGCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26/c1-16(2)13-9-5-8-12-15(16)14-10-6-3-4-7-11-14/h3-4,9,13-15H,5-8,10-12H2,1-2H3.
What are the key properties of 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene?
4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene has a molecular weight of 218.38 g/mol, XLogP of 5.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohept-4-en-1-yl-3,3-dimethylcycloheptene is sourced from PubChem (CID 54052123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).