About 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione
8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione (PubChem CID 54052598) has the molecular formula C12H18N4O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione |
| PubChem CID | 54052598 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(CCCCCCCO)nc2[nH]1 |
| InChI | InChI=1S/C12H18N4O3/c17-7-5-3-1-2-4-6-8-13-9-10(14-8)15-12(19)16-11(9)18/h17H,1-7H2,(H3,13,14,15,16,18,19) |
| InChIKey | LTYVUKRUAAVFEJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione?
The IUPAC name of 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione (CID 54052598) is 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione.
What is the SMILES notation for 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione?
The canonical SMILES for 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione is O=c1[nH]c(=O)c2[nH]c(CCCCCCCO)nc2[nH]1.
What is the InChIKey of 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione?
The InChIKey is LTYVUKRUAAVFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3/c17-7-5-3-1-2-4-6-8-13-9-10(14-8)15-12(19)16-11(9)18/h17H,1-7H2,(H3,13,14,15,16,18,19).
What are the key properties of 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione?
8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione has a molecular weight of 266.30 g/mol, XLogP of 0.42, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(7-hydroxyheptyl)-3,7-dihydropurine-2,6-dione is sourced from PubChem (CID 54052598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).