C26H39F5S — CID 54052657
[4-[1,2-difluoro-4-(4-octylcyclohexyl)cyclohexyl]phenyl]-trifluoro-λ4-sulfane (PubChem CID 54052657) has the molecular formula C26H39F5S and a molecular weight of 478.66 g/mol. Its IUPAC name is [4-[1,2-difluoro-4-(4-octylcyclohexyl)cyclohexyl]phenyl]-trifluoro-λ4-sulfane.
| Compound Name | [4-[1,2-difluoro-4-(4-octylcyclohexyl)cyclohexyl]phenyl]-trifluoro-λ4-sulfane |
|---|---|
| PubChem CID | 54052657 |
| Molecular Formula | C26H39F5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [4-[1,2-difluoro-4-(4-octylcyclohexyl)cyclohexyl]phenyl]-trifluoro-λ4-sulfane |
| SMILES | CCCCCCCCC1CCC(C2CCC(F)(c3ccc(S(F)(F)F)cc3)C(F)C2)CC1 |
| InChI | InChI=1S/C26H39F5S/c1-2-3-4-5-6-7-8-20-9-11-21(12-10-20)22-17-18-26(28,25(27)19-22)23-13-15-24(16-14-23)32(29,30)31/h13-16,20-22,25H,2-12,17-19H2,1H3 |
| InChIKey | LUAAJRRXQKGKTF-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|