C19H26N4O — CID 5405278
5-tert-butyl-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-1H-pyrazole-3-carboxamide (PubChem CID 5405278) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-tert-butyl-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5405278 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 5-tert-butyl-N-[(Z)-(4-tert-butylphenyl)methylideneamino]-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(/C=N\NC(=O)c2cc(C(C)(C)C)[nH]n2)cc1 |
| InChI | InChI=1S/C19H26N4O/c1-18(2,3)14-9-7-13(8-10-14)12-20-23-17(24)15-11-16(22-21-15)19(4,5)6/h7-12H,1-6H3,(H,21,22)(H,23,24)/b20-12- |
| InChIKey | DVSSOZNHTVAYIN-NDENLUEZSA-N |
| XLogP | 3.77 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|