C14H9F3O2S — CID 54052841
10-methyl-3-(trifluoromethylsulfonyl)tricyclo[6.2.2.02,7]dodeca-1,3,5,7,9,11-hexaene (PubChem CID 54052841) has the molecular formula C14H9F3O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is 10-methyl-3-(trifluoromethylsulfonyl)tricyclo[6.2.2.02,7]dodeca-1,3,5,7,9,11-hexaene.
| Compound Name | 10-methyl-3-(trifluoromethylsulfonyl)tricyclo[6.2.2.02,7]dodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 54052841 |
| Molecular Formula | C14H9F3O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 10-methyl-3-(trifluoromethylsulfonyl)tricyclo[6.2.2.02,7]dodeca-1,3,5,7,9,11-hexaene |
| SMILES | Cc1cc2ccc1c1c(S(=O)(=O)C(F)(F)F)cccc21 |
| InChI | InChI=1S/C14H9F3O2S/c1-8-7-9-5-6-10(8)13-11(9)3-2-4-12(13)20(18,19)14(15,16)17/h2-7H,1H3 |
| InChIKey | QJMYYSRPBDDRHK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |