C10H13F3O6S — CID 54053079
(2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid (PubChem CID 54053079) has the molecular formula C10H13F3O6S and a molecular weight of 318.27 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid.
| Compound Name | (2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid |
|---|---|
| PubChem CID | 54053079 |
| Molecular Formula | C10H13F3O6S |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | (2S)-2-[(2S)-2-methyl-3-sulfanylpropanoyl]oxy-4-oxo-4-(2,2,2-trifluoroethoxy)butanoic acid |
| SMILES | C[C@H](CS)C(=O)O[C@@H](CC(=O)OCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H13F3O6S/c1-5(3-20)9(17)19-6(8(15)16)2-7(14)18-4-10(11,12)13/h5-6,20H,2-4H2,1H3,(H,15,16)/t5-,6+/m1/s1 |
| InChIKey | LUHVZGAMOZMRQK-RITPCOANSA-N |
| XLogP | 1.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|