About 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione
1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione (PubChem CID 54053515) has the molecular formula C24H24N4O3
and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione |
| PubChem CID | 54053515 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione |
| SMILES | CNC(C)(NC)ON(c1ccccc1)c1ccc(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H24N4O3/c1-24(26-2,27-3)31-28(15-9-5-4-6-10-15)19-14-13-18(25)20-21(19)23(30)17-12-8-7-11-16(17)22(20)29/h4-14,26-27H,25H2,1-3H3 |
| InChIKey | LUPJDDMZHVZFHH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione?
The IUPAC name of 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione (CID 54053515) is 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione.
What is the SMILES notation for 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione?
The canonical SMILES for 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione is CNC(C)(NC)ON(c1ccccc1)c1ccc(N)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione?
The InChIKey is LUPJDDMZHVZFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O3/c1-24(26-2,27-3)31-28(15-9-5-4-6-10-15)19-14-13-18(25)20-21(19)23(30)17-12-8-7-11-16(17)22(20)29/h4-14,26-27H,25H2,1-3H3.
What are the key properties of 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione?
1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione has a molecular weight of 416.48 g/mol, XLogP of 3.23, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-4-[N-[1,1-bis(methylamino)ethoxy]anilino]anthracene-9,10-dione is sourced from PubChem (CID 54053515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).