About 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine
9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine (PubChem CID 54053692) has the molecular formula C12H10F2N6
and a molecular weight of 276.25 g/mol. Its IUPAC name is 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine.
Molecular Properties
| Compound Name | 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine |
| PubChem CID | 54053692 |
| Molecular Formula | C12H10F2N6 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine |
| SMILES | Nc1nc(N)c2ncn(Cc3c(F)cccc3F)c2n1 |
| InChI | InChI=1S/C12H10F2N6/c13-7-2-1-3-8(14)6(7)4-20-5-17-9-10(15)18-12(16)19-11(9)20/h1-3,5H,4H2,(H4,15,16,18,19) |
| InChIKey | LUSHWASUEQEOTG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine?
The IUPAC name of 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine (CID 54053692) is 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine.
What is the SMILES notation for 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine?
The canonical SMILES for 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine is Nc1nc(N)c2ncn(Cc3c(F)cccc3F)c2n1.
What is the InChIKey of 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine?
The InChIKey is LUSHWASUEQEOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N6/c13-7-2-1-3-8(14)6(7)4-20-5-17-9-10(15)18-12(16)19-11(9)20/h1-3,5H,4H2,(H4,15,16,18,19).
What are the key properties of 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine?
9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine has a molecular weight of 276.25 g/mol, XLogP of 1.32, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-difluorophenyl)methyl]purine-2,6-diamine is sourced from PubChem (CID 54053692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).