C12H14O3 — CID 54053914
6,7,8,9,9a,10-hexahydro-5aH-pyrano[4,3-b]chromen-1-one (PubChem CID 54053914) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 6,7,8,9,9a,10-hexahydro-5aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | 6,7,8,9,9a,10-hexahydro-5aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 54053914 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 6,7,8,9,9a,10-hexahydro-5aH-pyrano[4,3-b]chromen-1-one |
| SMILES | O=c1occc2c1CC1CCCCC1O2 |
| InChI | InChI=1S/C12H14O3/c13-12-9-7-8-3-1-2-4-10(8)15-11(9)5-6-14-12/h5-6,8,10H,1-4,7H2 |
| InChIKey | LUWQJYXXEPKELR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |