About 2-aminooctadec-4-ene-1,3,6-triol
2-aminooctadec-4-ene-1,3,6-triol (PubChem CID 54054101) has the molecular formula C18H37NO3
and a molecular weight of 315.50 g/mol. Its IUPAC name is 2-aminooctadec-4-ene-1,3,6-triol.
Molecular Properties
| Compound Name | 2-aminooctadec-4-ene-1,3,6-triol |
| PubChem CID | 54054101 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | 2-aminooctadec-4-ene-1,3,6-triol |
| SMILES | CCCCCCCCCCCCC(O)C=CC(O)C(N)CO |
| InChI | InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-16(21)13-14-18(22)17(19)15-20/h13-14,16-18,20-22H,2-12,15,19H2,1H3 |
| InChIKey | LUZYTSCABOWJAC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooctadec-4-ene-1,3,6-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooctadec-4-ene-1,3,6-triol?
The IUPAC name of 2-aminooctadec-4-ene-1,3,6-triol (CID 54054101) is 2-aminooctadec-4-ene-1,3,6-triol.
What is the SMILES notation for 2-aminooctadec-4-ene-1,3,6-triol?
The canonical SMILES for 2-aminooctadec-4-ene-1,3,6-triol is CCCCCCCCCCCCC(O)C=CC(O)C(N)CO.
What is the InChIKey of 2-aminooctadec-4-ene-1,3,6-triol?
The InChIKey is LUZYTSCABOWJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-16(21)13-14-18(22)17(19)15-20/h13-14,16-18,20-22H,2-12,15,19H2,1H3.
What are the key properties of 2-aminooctadec-4-ene-1,3,6-triol?
2-aminooctadec-4-ene-1,3,6-triol has a molecular weight of 315.50 g/mol, XLogP of 2.89, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooctadec-4-ene-1,3,6-triol is sourced from PubChem (CID 54054101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).