C16H20O4 — CID 54054155
[2,2,4-trimethyl-3-(3-methyl-5-oxopenta-1,3-dienyl)-5-oxocyclopent-3-en-1-yl] acetate (PubChem CID 54054155) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [2,2,4-trimethyl-3-(3-methyl-5-oxopenta-1,3-dienyl)-5-oxocyclopent-3-en-1-yl] acetate.
| Compound Name | [2,2,4-trimethyl-3-(3-methyl-5-oxopenta-1,3-dienyl)-5-oxocyclopent-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 54054155 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [2,2,4-trimethyl-3-(3-methyl-5-oxopenta-1,3-dienyl)-5-oxocyclopent-3-en-1-yl] acetate |
| SMILES | CC(=O)OC1C(=O)C(C)=C(C=CC(C)=CC=O)C1(C)C |
| InChI | InChI=1S/C16H20O4/c1-10(8-9-17)6-7-13-11(2)14(19)15(16(13,4)5)20-12(3)18/h6-9,15H,1-5H3 |
| InChIKey | LVAZZJDLBYTXIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|