About 3-ethoxy-1H-pyrrole-2,5-diol
3-ethoxy-1H-pyrrole-2,5-diol (PubChem CID 54054553) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-ethoxy-1H-pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 3-ethoxy-1H-pyrrole-2,5-diol |
| PubChem CID | 54054553 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3-ethoxy-1H-pyrrole-2,5-diol |
| SMILES | CCOc1cc(O)[nH]c1O |
| InChI | InChI=1S/C6H9NO3/c1-2-10-4-3-5(8)7-6(4)9/h3,7-9H,2H2,1H3 |
| InChIKey | LVIMHDKXMQAKFY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxy-1H-pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1H-pyrrole-2,5-diol?
The IUPAC name of 3-ethoxy-1H-pyrrole-2,5-diol (CID 54054553) is 3-ethoxy-1H-pyrrole-2,5-diol.
What is the SMILES notation for 3-ethoxy-1H-pyrrole-2,5-diol?
The canonical SMILES for 3-ethoxy-1H-pyrrole-2,5-diol is CCOc1cc(O)[nH]c1O.
What is the InChIKey of 3-ethoxy-1H-pyrrole-2,5-diol?
The InChIKey is LVIMHDKXMQAKFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-10-4-3-5(8)7-6(4)9/h3,7-9H,2H2,1H3.
What are the key properties of 3-ethoxy-1H-pyrrole-2,5-diol?
3-ethoxy-1H-pyrrole-2,5-diol has a molecular weight of 143.14 g/mol, XLogP of 0.82, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1H-pyrrole-2,5-diol is sourced from PubChem (CID 54054553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).