About N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine
N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine (PubChem CID 54054816) has the molecular formula C25H33N3O2S
and a molecular weight of 439.63 g/mol. Its IUPAC name is N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine.
Molecular Properties
| Compound Name | N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
| PubChem CID | 54054816 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
| SMILES | COc1ccccc1OCCCCN1CCC(N(C)C2=Nc3ccccc3CS2)CC1 |
| InChI | InChI=1S/C25H33N3O2S/c1-27(25-26-22-10-4-3-9-20(22)19-31-25)21-13-16-28(17-14-21)15-7-8-18-30-24-12-6-5-11-23(24)29-2/h3-6,9-12,21H,7-8,13-19H2,1-2H3 |
| InChIKey | LVMPVQQLBAGSHH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine?
The IUPAC name of N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine (CID 54054816) is N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine.
What is the SMILES notation for N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine?
The canonical SMILES for N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine is COc1ccccc1OCCCCN1CCC(N(C)C2=Nc3ccccc3CS2)CC1.
What is the InChIKey of N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine?
The InChIKey is LVMPVQQLBAGSHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H33N3O2S/c1-27(25-26-22-10-4-3-9-20(22)19-31-25)21-13-16-28(17-14-21)15-7-8-18-30-24-12-6-5-11-23(24)29-2/h3-6,9-12,21H,7-8,13-19H2,1-2H3.
What are the key properties of N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine?
N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine has a molecular weight of 439.63 g/mol, XLogP of 5.18, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(2-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine is sourced from PubChem (CID 54054816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).