About 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane
8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane (PubChem CID 54054865) has the molecular formula C14H10ClF4N3O
and a molecular weight of 347.70 g/mol. Its IUPAC name is 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane.
Molecular Properties
| Compound Name | 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane |
| PubChem CID | 54054865 |
| Molecular Formula | C14H10ClF4N3O |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane |
| SMILES | Cc1cc(-n2c(=O)c(F)c(F)n3ccnc23)ccc1Cl.FCF |
| InChI | InChI=1S/C13H8ClF2N3O.CH2F2/c1-7-6-8(2-3-9(7)14)19-12(20)10(15)11(16)18-5-4-17-13(18)19;2-1-3/h2-6H,1H3;1H2 |
| InChIKey | LVNHFUHLKXZXLW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane?
The IUPAC name of 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane (CID 54054865) is 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane.
What is the SMILES notation for 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane?
The canonical SMILES for 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane is Cc1cc(-n2c(=O)c(F)c(F)n3ccnc23)ccc1Cl.FCF.
What is the InChIKey of 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane?
The InChIKey is LVNHFUHLKXZXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF2N3O.CH2F2/c1-7-6-8(2-3-9(7)14)19-12(20)10(15)11(16)18-5-4-17-13(18)19;2-1-3/h2-6H,1H3;1H2.
What are the key properties of 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane?
8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane has a molecular weight of 347.70 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-chloro-3-methylphenyl)-5,6-difluoroimidazo[1,2-a]pyrimidin-7-one;difluoromethane is sourced from PubChem (CID 54054865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).