C9H3F11O2 — CID 54055049
3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoic acid (PubChem CID 54055049) has the molecular formula C9H3F11O2 and a molecular weight of 352.10 g/mol. Its IUPAC name is 3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoic acid.
| Compound Name | 3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54055049 |
| Molecular Formula | C9H3F11O2 |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)prop-2-enoic acid |
| SMILES | O=C(O)C=CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H3F11O2/c10-4(2-1-3(21)22)5(11,12)7(15,16)9(19,20)8(17,18)6(4,13)14/h1-2H,(H,21,22) |
| InChIKey | LVQPOGJKUGATDE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|