C9H18O6 — CID 54055102
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2,3-dimethylheptanal (PubChem CID 54055102) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2,3-dimethylheptanal.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2,3-dimethylheptanal |
|---|---|
| PubChem CID | 54055102 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-2,3-dimethylheptanal |
| SMILES | CC(O)[C@@H](O)[C@@H](O)[C@](C)(O)[C@@](C)(O)C=O |
| InChI | InChI=1S/C9H18O6/c1-5(11)6(12)7(13)9(3,15)8(2,14)4-10/h4-7,11-15H,1-3H3/t5?,6-,7-,8+,9+/m1/s1 |
| InChIKey | LVRLWXWWPBPNLH-BDBGQCIPSA-N |
| XLogP | -2.21 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|