About (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate
(1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate (PubChem CID 54055274) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate |
| PubChem CID | 54055274 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate |
| SMILES | CC1CCN(C)C(COC(=O)CN(C)C)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-10-5-6-14(4)11(7-10)9-16-12(15)8-13(2)3/h10-11H,5-9H2,1-4H3 |
| InChIKey | LVUIOYMWVQGTDG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate?
The IUPAC name of (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate (CID 54055274) is (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate.
What is the SMILES notation for (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate?
The canonical SMILES for (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate is CC1CCN(C)C(COC(=O)CN(C)C)C1.
What is the InChIKey of (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate?
The InChIKey is LVUIOYMWVQGTDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-10-5-6-14(4)11(7-10)9-16-12(15)8-13(2)3/h10-11H,5-9H2,1-4H3.
What are the key properties of (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate?
(1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate has a molecular weight of 228.34 g/mol, XLogP of 0.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethylpiperidin-2-yl)methyl 2-(dimethylamino)acetate is sourced from PubChem (CID 54055274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).