About 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline
3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline (PubChem CID 54055519) has the molecular formula C19H24ClN3O
and a molecular weight of 345.87 g/mol. Its IUPAC name is 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline.
Molecular Properties
| Compound Name | 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline |
| PubChem CID | 54055519 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline |
| SMILES | CCN(CC)c1ccc(C=NN(C)c2ccc(OC)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H24ClN3O/c1-5-23(6-2)17-8-7-15(19(20)13-17)14-21-22(3)16-9-11-18(24-4)12-10-16/h7-14H,5-6H2,1-4H3 |
| InChIKey | LVYWFLRFICXEEK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline?
The IUPAC name of 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline (CID 54055519) is 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline.
What is the SMILES notation for 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline?
The canonical SMILES for 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline is CCN(CC)c1ccc(C=NN(C)c2ccc(OC)cc2)c(Cl)c1.
What is the InChIKey of 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline?
The InChIKey is LVYWFLRFICXEEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24ClN3O/c1-5-23(6-2)17-8-7-15(19(20)13-17)14-21-22(3)16-9-11-18(24-4)12-10-16/h7-14H,5-6H2,1-4H3.
What are the key properties of 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline?
3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline has a molecular weight of 345.87 g/mol, XLogP of 4.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-diethyl-4-[[(4-methoxyphenyl)-methylhydrazinylidene]methyl]aniline is sourced from PubChem (CID 54055519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).