C34H46O16S — CID 54055636
(3,4-diacetyloxy-5-methyl-6-phenylsulfanyloxan-2-yl)methyl acetate;(3,4,6-triacetyloxy-5-methyloxan-2-yl)methyl acetate (PubChem CID 54055636) has the molecular formula C34H46O16S and a molecular weight of 742.79 g/mol. Its IUPAC name is (3,4-diacetyloxy-5-methyl-6-phenylsulfanyloxan-2-yl)methyl acetate;(3,4,6-triacetyloxy-5-methyloxan-2-yl)methyl acetate.
| Compound Name | (3,4-diacetyloxy-5-methyl-6-phenylsulfanyloxan-2-yl)methyl acetate;(3,4,6-triacetyloxy-5-methyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 54055636 |
| Molecular Formula | C34H46O16S |
| Molecular Weight | 742.79 g/mol |
| Exact Mass | 742.25 |
| IUPAC Name | (3,4-diacetyloxy-5-methyl-6-phenylsulfanyloxan-2-yl)methyl acetate;(3,4,6-triacetyloxy-5-methyloxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(C)C(OC(C)=O)C1OC(C)=O.CC(=O)OCC1OC(Sc2ccccc2)C(C)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H24O7S.C15H22O9/c1-11-17(24-13(3)21)18(25-14(4)22)16(10-23-12(2)20)26-19(11)27-15-8-6-5-7-9-15;1-7-13(21-9(3)17)14(22-10(4)18)12(6-20-8(2)16)24-15(7)23-11(5)19/h5-9,11,16-19H,10H2,1-4H3;7,12-15H,6H2,1-5H3 |
| InChIKey | LWAXXRVKQNDAGG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 202.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|