C13H15N3O3 — CID 5405573
[(Z)-1-[(2R,4R)-5-oxo-4-phenyloxolan-2-yl]ethylideneamino]urea (PubChem CID 5405573) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is [(Z)-1-[(2R,4R)-5-oxo-4-phenyloxolan-2-yl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[(2R,4R)-5-oxo-4-phenyloxolan-2-yl]ethylideneamino]urea |
|---|---|
| PubChem CID | 5405573 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [(Z)-1-[(2R,4R)-5-oxo-4-phenyloxolan-2-yl]ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)[C@H]1C[C@H](c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C13H15N3O3/c1-8(15-16-13(14)18)11-7-10(12(17)19-11)9-5-3-2-4-6-9/h2-6,10-11H,7H2,1H3,(H3,14,16,18)/b15-8-/t10-,11-/m1/s1 |
| InChIKey | MSIUWGXISBNJFT-UFCGYKGRSA-N |
| XLogP | 1.13 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|