About 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine
2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine (PubChem CID 54056224) has the molecular formula C23H14ClF2N
and a molecular weight of 377.82 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine |
| PubChem CID | 54056224 |
| Molecular Formula | C23H14ClF2N |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine |
| SMILES | Fc1ccc(-c2cnc(-c3cccc(Cl)c3)c(-c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C23H14ClF2N/c24-19-3-1-2-17(12-19)23-22(16-6-10-21(26)11-7-16)13-18(14-27-23)15-4-8-20(25)9-5-15/h1-14H |
| InChIKey | PRSUMUSEJHHYQK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine?
The IUPAC name of 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine (CID 54056224) is 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine.
What is the SMILES notation for 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine?
The canonical SMILES for 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine is Fc1ccc(-c2cnc(-c3cccc(Cl)c3)c(-c3ccc(F)cc3)c2)cc1.
What is the InChIKey of 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine?
The InChIKey is PRSUMUSEJHHYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14ClF2N/c24-19-3-1-2-17(12-19)23-22(16-6-10-21(26)11-7-16)13-18(14-27-23)15-4-8-20(25)9-5-15/h1-14H.
What are the key properties of 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine?
2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine has a molecular weight of 377.82 g/mol, XLogP of 7.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-3,5-bis(4-fluorophenyl)pyridine is sourced from PubChem (CID 54056224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).