About 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine
5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine (PubChem CID 54056354) has the molecular formula C18H14Cl3N3OS
and a molecular weight of 426.76 g/mol. Its IUPAC name is 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine.
Molecular Properties
| Compound Name | 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine |
| PubChem CID | 54056354 |
| Molecular Formula | C18H14Cl3N3OS |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine |
| SMILES | Clc1ccc(SCCOC(=Cn2ccnc2)c2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C18H14Cl3N3OS/c19-13-1-3-15(16(21)9-13)17(11-24-6-5-22-12-24)25-7-8-26-18-4-2-14(20)10-23-18/h1-6,9-12H,7-8H2 |
| InChIKey | LWNRXWBLGYOTOM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine?
The IUPAC name of 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine (CID 54056354) is 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine.
What is the SMILES notation for 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine?
The canonical SMILES for 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine is Clc1ccc(SCCOC(=Cn2ccnc2)c2ccc(Cl)cc2Cl)nc1.
What is the InChIKey of 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine?
The InChIKey is LWNRXWBLGYOTOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl3N3OS/c19-13-1-3-15(16(21)9-13)17(11-24-6-5-22-12-24)25-7-8-26-18-4-2-14(20)10-23-18/h1-6,9-12H,7-8H2.
What are the key properties of 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine?
5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine has a molecular weight of 426.76 g/mol, XLogP of 6.00, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[2-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenoxy]ethylsulfanyl]pyridine is sourced from PubChem (CID 54056354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).