C35H35Cl2N7O3 — CID 54056381
2-[4-[[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]methyl]phenyl]-4-methylpyrimidine (PubChem CID 54056381) has the molecular formula C35H35Cl2N7O3 and a molecular weight of 672.62 g/mol. Its IUPAC name is 2-[4-[[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]methyl]phenyl]-4-methylpyrimidine.
| Compound Name | 2-[4-[[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]methyl]phenyl]-4-methylpyrimidine |
|---|---|
| PubChem CID | 54056381 |
| Molecular Formula | C35H35Cl2N7O3 |
| Molecular Weight | 672.62 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | 2-[4-[[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]methyl]phenyl]-4-methylpyrimidine |
| SMILES | Cc1ccnc(-c2ccc(CN3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)n1 |
| InChI | InChI=1S/C35H35Cl2N7O3/c1-25-12-13-39-34(41-25)27-4-2-26(3-5-27)19-42-14-16-43(17-15-42)29-7-9-30(10-8-29)45-20-31-21-46-35(47-31,22-44-24-38-23-40-44)32-11-6-28(36)18-33(32)37/h2-13,18,23-24,31H,14-17,19-22H2,1H3/t31-,35-/m1/s1 |
| InChIKey | LWOFCXNZORCQDW-CYEXUTLASA-N |
| XLogP | 6.02 |
| TPSA | 90.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|