C19H20N8O7S3 — CID 54056630
(6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54056630) has the molecular formula C19H20N8O7S3 and a molecular weight of 568.62 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54056630 |
| Molecular Formula | C19H20N8O7S3 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-ethyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCn1c(SCC2=C(C(=O)O)N3C(=O)C(NC(=O)C(=NOC)c4csc(N)n4)[C@@H]3SC2)n[nH]c(=O)c1=O |
| InChI | InChI=1S/C19H20N8O7S3/c1-3-26-15(31)13(29)23-24-19(26)37-5-7-4-35-16-10(14(30)27(16)11(7)17(32)33)22-12(28)9(25-34-2)8-6-36-18(20)21-8/h6,10,16H,3-5H2,1-2H3,(H2,20,21)(H,22,28)(H,23,29)(H,32,33)/t10?,16-/m0/s1 |
| InChIKey | LWSKFOKYTLACHT-CSPPYYTDSA-N |
| XLogP | -1.13 |
| TPSA | 214.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|