About 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine
1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 54056751) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine |
| PubChem CID | 54056751 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCC(N)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C14H21N3/c1-17(2)9-3-4-13(15)12-6-5-11-7-8-16-14(11)10-12/h5-8,10,13,16H,3-4,9,15H2,1-2H3 |
| InChIKey | MPVJVAHPNYRAQR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine?
The IUPAC name of 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine (CID 54056751) is 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine.
What is the SMILES notation for 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine?
The canonical SMILES for 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine is CN(C)CCCC(N)c1ccc2cc[nH]c2c1.
What is the InChIKey of 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine?
The InChIKey is MPVJVAHPNYRAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-17(2)9-3-4-13(15)12-6-5-11-7-8-16-14(11)10-12/h5-8,10,13,16H,3-4,9,15H2,1-2H3.
What are the key properties of 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine?
1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine has a molecular weight of 231.34 g/mol, XLogP of 2.51, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indol-6-yl)-N',N'-dimethylbutane-1,4-diamine is sourced from PubChem (CID 54056751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).