C14H26O3 — CID 54056974
2,2-diethoxycyclodecan-1-one (PubChem CID 54056974) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,2-diethoxycyclodecan-1-one.
| Compound Name | 2,2-diethoxycyclodecan-1-one |
|---|---|
| PubChem CID | 54056974 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2,2-diethoxycyclodecan-1-one |
| SMILES | CCOC1(OCC)CCCCCCCCC1=O |
| InChI | InChI=1S/C14H26O3/c1-3-16-14(17-4-2)12-10-8-6-5-7-9-11-13(14)15/h3-12H2,1-2H3 |
| InChIKey | LWXYQKRKNXTPQS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|